C15H26N2O3S2 — CID 111858472
N-[2-[2-(2-hydroxy-2-thiophen-2-ylethyl)azepan-1-yl]ethyl]methanesulfonamide (PubChem CID 111858472) has the molecular formula C15H26N2O3S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxy-2-thiophen-2-ylethyl)azepan-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-(2-hydroxy-2-thiophen-2-ylethyl)azepan-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 111858472 |
| Molecular Formula | C15H26N2O3S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[2-[2-(2-hydroxy-2-thiophen-2-ylethyl)azepan-1-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CCCCCC1CC(O)c1cccs1 |
| InChI | InChI=1S/C15H26N2O3S2/c1-22(19,20)16-8-10-17-9-4-2-3-6-13(17)12-14(18)15-7-5-11-21-15/h5,7,11,13-14,16,18H,2-4,6,8-10,12H2,1H3 |
| InChIKey | GFKQDIUEPIUQDT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |