C18H31ClN2OS — CID 120901659
2-[1-[(3-methylpyrrolidin-3-yl)methyl]azepan-2-yl]-1-thiophen-2-ylethanol;hydrochloride (PubChem CID 120901659) has the molecular formula C18H31ClN2OS and a molecular weight of 358.98 g/mol. Its IUPAC name is 2-[1-[(3-methylpyrrolidin-3-yl)methyl]azepan-2-yl]-1-thiophen-2-ylethanol;hydrochloride.
| Compound Name | 2-[1-[(3-methylpyrrolidin-3-yl)methyl]azepan-2-yl]-1-thiophen-2-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 120901659 |
| Molecular Formula | C18H31ClN2OS |
| Molecular Weight | 358.98 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-[1-[(3-methylpyrrolidin-3-yl)methyl]azepan-2-yl]-1-thiophen-2-ylethanol;hydrochloride |
| SMILES | CC1(CN2CCCCCC2CC(O)c2cccs2)CCNC1.Cl |
| InChI | InChI=1S/C18H30N2OS.ClH/c1-18(8-9-19-13-18)14-20-10-4-2-3-6-15(20)12-16(21)17-7-5-11-22-17;/h5,7,11,15-16,19,21H,2-4,6,8-10,12-14H2,1H3;1H |
| InChIKey | HDJPCXMRIJPMPM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |