C14H29ClN2 — CID 120900766
2-ethyl-1-[(3-methylpyrrolidin-3-yl)methyl]azepane;hydrochloride (PubChem CID 120900766) has the molecular formula C14H29ClN2 and a molecular weight of 260.85 g/mol. Its IUPAC name is 2-ethyl-1-[(3-methylpyrrolidin-3-yl)methyl]azepane;hydrochloride.
| Compound Name | 2-ethyl-1-[(3-methylpyrrolidin-3-yl)methyl]azepane;hydrochloride |
|---|---|
| PubChem CID | 120900766 |
| Molecular Formula | C14H29ClN2 |
| Molecular Weight | 260.85 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-ethyl-1-[(3-methylpyrrolidin-3-yl)methyl]azepane;hydrochloride |
| SMILES | CCC1CCCCCN1CC1(C)CCNC1.Cl |
| InChI | InChI=1S/C14H28N2.ClH/c1-3-13-7-5-4-6-10-16(13)12-14(2)8-9-15-11-14;/h13,15H,3-12H2,1-2H3;1H |
| InChIKey | KNSGBPUWWHVVJL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |