C14H28N2 — CID 63132783
2-ethyl-1-[(3-methylpiperidin-3-yl)methyl]piperidine (PubChem CID 63132783) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-ethyl-1-[(3-methylpiperidin-3-yl)methyl]piperidine.
| Compound Name | 2-ethyl-1-[(3-methylpiperidin-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 63132783 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-ethyl-1-[(3-methylpiperidin-3-yl)methyl]piperidine |
| SMILES | CCC1CCCCN1CC1(C)CCCNC1 |
| InChI | InChI=1S/C14H28N2/c1-3-13-7-4-5-10-16(13)12-14(2)8-6-9-15-11-14/h13,15H,3-12H2,1-2H3 |
| InChIKey | QIVUBVKNLFVQPJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |