C14H29ClN2 — CID 120899808
2-tert-butyl-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine;hydrochloride (PubChem CID 120899808) has the molecular formula C14H29ClN2 and a molecular weight of 260.85 g/mol. Its IUPAC name is 2-tert-butyl-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine;hydrochloride.
| Compound Name | 2-tert-butyl-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 120899808 |
| Molecular Formula | C14H29ClN2 |
| Molecular Weight | 260.85 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-tert-butyl-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine;hydrochloride |
| SMILES | CC1(CN2CCCC2C(C)(C)C)CCNC1.Cl |
| InChI | InChI=1S/C14H28N2.ClH/c1-13(2,3)12-6-5-9-16(12)11-14(4)7-8-15-10-14;/h12,15H,5-11H2,1-4H3;1H |
| InChIKey | MBMZRSUTRLOTIE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |