C14H23ClN2S — CID 120897555
1-[(3-methylpyrrolidin-3-yl)methyl]-2-thiophen-2-ylpyrrolidine;hydrochloride (PubChem CID 120897555) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is 1-[(3-methylpyrrolidin-3-yl)methyl]-2-thiophen-2-ylpyrrolidine;hydrochloride.
| Compound Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-2-thiophen-2-ylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 120897555 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-[(3-methylpyrrolidin-3-yl)methyl]-2-thiophen-2-ylpyrrolidine;hydrochloride |
| SMILES | CC1(CN2CCCC2c2cccs2)CCNC1.Cl |
| InChI | InChI=1S/C14H22N2S.ClH/c1-14(6-7-15-10-14)11-16-8-2-4-12(16)13-5-3-9-17-13;/h3,5,9,12,15H,2,4,6-8,10-11H2,1H3;1H |
| InChIKey | YVAUZTJOLPQSIZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |