C15H21N3O2S — CID 35429886
5,5-dimethyl-3-[2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 35429886) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35429886 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCN2CCC[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-15(2)13(19)18(14(20)16-15)9-8-17-7-3-5-11(17)12-6-4-10-21-12/h4,6,10-11H,3,5,7-9H2,1-2H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | IRBZPKWBPRQSBT-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|