C23H23N3O2S — CID 11925361
(5S)-5-methyl-5-naphthalen-2-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 11925361) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is (5S)-5-methyl-5-naphthalen-2-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-naphthalen-2-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11925361 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (5S)-5-methyl-5-naphthalen-2-yl-3-[[(2R)-2-thiophen-2-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc3ccccc3c2)NC(=O)N(CN2CCC[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C23H23N3O2S/c1-23(18-11-10-16-6-2-3-7-17(16)14-18)21(27)26(22(28)24-23)15-25-12-4-8-19(25)20-9-5-13-29-20/h2-3,5-7,9-11,13-14,19H,4,8,12,15H2,1H3,(H,24,28)/t19-,23+/m1/s1 |
| InChIKey | VREFHKJCCHAXIQ-XXBNENTESA-N |
| XLogP | 4.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|