C20H23N3O3 — CID 51725456
(5R)-5-methyl-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 51725456) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (5R)-5-methyl-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51725456 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (5R)-5-methyl-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@H]1CN(CN2C(=O)N[C@](C)(c3ccc4ccccc4c3)C2=O)CCO1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-12-22(9-10-26-14)13-23-18(24)20(2,21-19(23)25)17-8-7-15-5-3-4-6-16(15)11-17/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,21,25)/t14-,20+/m0/s1 |
| InChIKey | ARBQBVGLAKOPLX-VBKZILBWSA-N |
| XLogP | 2.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|