C27H30N4O3 — CID 31056016
(5R)-3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 31056016) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (5R)-3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31056016 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (5R)-3-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CCOc1ccccc1N1CCN(CN2C(=O)N[C@](C)(c3ccc4ccccc4c3)C2=O)CC1 |
| InChI | InChI=1S/C27H30N4O3/c1-3-34-24-11-7-6-10-23(24)30-16-14-29(15-17-30)19-31-25(32)27(2,28-26(31)33)22-13-12-20-8-4-5-9-21(20)18-22/h4-13,18H,3,14-17,19H2,1-2H3,(H,28,33)/t27-/m1/s1 |
| InChIKey | LLYOLLHIPHJUSK-HHHXNRCGSA-N |
| XLogP | 3.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|