C28H32N4O2 — CID 31388762
(5R)-5-methyl-3-[[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 31388762) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is (5R)-5-methyl-3-[[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31388762 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (5R)-5-methyl-3-[[methyl-[(2-piperidin-1-ylphenyl)methyl]amino]methyl]-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CN(Cc1ccccc1N1CCCCC1)CN1C(=O)N[C@](C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C28H32N4O2/c1-28(24-15-14-21-10-4-5-11-22(21)18-24)26(33)32(27(34)29-28)20-30(2)19-23-12-6-7-13-25(23)31-16-8-3-9-17-31/h4-7,10-15,18H,3,8-9,16-17,19-20H2,1-2H3,(H,29,34)/t28-/m1/s1 |
| InChIKey | CZPOTDYOCCKRKL-MUUNZHRXSA-N |
| XLogP | 4.69 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|