C28H27N5O3 — CID 154860165
3-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 154860165) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 3-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154860165 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)C1=O |
| InChI | InChI=1S/C28H27N5O3/c1-28(21-11-10-18-6-2-3-7-20(18)16-21)26(35)33(27(36)31-28)17-24(34)32-14-12-19(13-15-32)25-29-22-8-4-5-9-23(22)30-25/h2-11,16,19H,12-15,17H2,1H3,(H,29,30)(H,31,36) |
| InChIKey | LBJLUFBAQIHHLQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|