C26H22N4O3 — CID 166210015
N-methyl-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-2-ylacetamide (PubChem CID 166210015) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-2-ylacetamide.
| Compound Name | N-methyl-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-2-ylacetamide |
|---|---|
| PubChem CID | 166210015 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-methyl-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)-N-quinolin-2-ylacetamide |
| SMILES | CN(C(=O)CN1C(=O)NC(C)(c2ccc3ccccc3c2)C1=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H22N4O3/c1-26(20-13-11-17-7-3-4-9-19(17)15-20)24(32)30(25(33)28-26)16-23(31)29(2)22-14-12-18-8-5-6-10-21(18)27-22/h3-15H,16H2,1-2H3,(H,28,33) |
| InChIKey | PSZPNFHDPGBMPX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|