C26H28N4O4S — CID 42911362
3-[(4-benzylsulfonylpiperazin-1-yl)methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 42911362) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-[(4-benzylsulfonylpiperazin-1-yl)methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-benzylsulfonylpiperazin-1-yl)methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42911362 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[(4-benzylsulfonylpiperazin-1-yl)methyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CN2CCN(S(=O)(=O)Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C26H28N4O4S/c1-26(23-12-11-21-9-5-6-10-22(21)17-23)24(31)30(25(32)27-26)19-28-13-15-29(16-14-28)35(33,34)18-20-7-3-2-4-8-20/h2-12,17H,13-16,18-19H2,1H3,(H,27,32) |
| InChIKey | ODIXAIFMYPVKCR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|