C26H28N4O2 — CID 30629728
(5S)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 30629728) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (5S)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30629728 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (5S)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(CN2CCN(Cc3cccc4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C26H28N4O2/c1-26(22-11-3-2-4-12-22)24(31)30(25(32)27-26)19-29-16-14-28(15-17-29)18-21-10-7-9-20-8-5-6-13-23(20)21/h2-13H,14-19H2,1H3,(H,27,32)/t26-/m0/s1 |
| InChIKey | AJSBHIOHEIHDTC-SANMLTNESA-N |
| XLogP | 3.38 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|