C19H21N3O2 — CID 9403666
(5R)-5-methyl-5-naphthalen-1-yl-3-(pyrrolidin-1-ylmethyl)imidazolidine-2,4-dione (PubChem CID 9403666) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (5R)-5-methyl-5-naphthalen-1-yl-3-(pyrrolidin-1-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-5-naphthalen-1-yl-3-(pyrrolidin-1-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9403666 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (5R)-5-methyl-5-naphthalen-1-yl-3-(pyrrolidin-1-ylmethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cccc3ccccc23)NC(=O)N(CN2CCCC2)C1=O |
| InChI | InChI=1S/C19H21N3O2/c1-19(16-10-6-8-14-7-2-3-9-15(14)16)17(23)22(18(24)20-19)13-21-11-4-5-12-21/h2-3,6-10H,4-5,11-13H2,1H3,(H,20,24)/t19-/m1/s1 |
| InChIKey | GREZPDVPPOBBIK-LJQANCHMSA-N |
| XLogP | 2.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|