C18H16Cl2N2O2 — CID 43022994
3-[(2,2-dichlorocyclopropyl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione (PubChem CID 43022994) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3-[(2,2-dichlorocyclopropyl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43022994 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cccc3ccccc23)NC(=O)N(CC2CC2(Cl)Cl)C1=O |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-17(14-8-4-6-11-5-2-3-7-13(11)14)15(23)22(16(24)21-17)10-12-9-18(12,19)20/h2-8,12H,9-10H2,1H3,(H,21,24) |
| InChIKey | IUYTZHVQIXETIZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|