C14H12Cl2F2N2O2 — CID 30343761
(5S)-3-[[(1R)-2,2-dichlorocyclopropyl]methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 30343761) has the molecular formula C14H12Cl2F2N2O2 and a molecular weight of 349.16 g/mol. Its IUPAC name is (5S)-3-[[(1R)-2,2-dichlorocyclopropyl]methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[(1R)-2,2-dichlorocyclopropyl]methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30343761 |
| Molecular Formula | C14H12Cl2F2N2O2 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (5S)-3-[[(1R)-2,2-dichlorocyclopropyl]methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cc(F)ccc2F)NC(=O)N(C[C@H]2CC2(Cl)Cl)C1=O |
| InChI | InChI=1S/C14H12Cl2F2N2O2/c1-13(9-4-8(17)2-3-10(9)18)11(21)20(12(22)19-13)6-7-5-14(7,15)16/h2-4,7H,5-6H2,1H3,(H,19,22)/t7-,13+/m1/s1 |
| InChIKey | XAFUWAUNQJUWLH-UHLUBPPHSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|