C18H16F2N2O2 — CID 7562098
(5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 7562098) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7562098 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (5R)-5-(2,5-difluorophenyl)-5-methyl-3-[(2-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1CN1C(=O)N[C@](C)(c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C18H16F2N2O2/c1-11-5-3-4-6-12(11)10-22-16(23)18(2,21-17(22)24)14-9-13(19)7-8-15(14)20/h3-9H,10H2,1-2H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | UZMAMSBLHSLISA-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|