C18H13F5N2O2 — CID 46815559
5-(2,5-difluorophenyl)-5-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 46815559) has the molecular formula C18H13F5N2O2 and a molecular weight of 384.30 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-5-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-5-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46815559 |
| Molecular Formula | C18H13F5N2O2 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-(2,5-difluorophenyl)-5-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(Cc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H13F5N2O2/c1-17(13-8-12(19)5-6-14(13)20)15(26)25(16(27)24-17)9-10-3-2-4-11(7-10)18(21,22)23/h2-8H,9H2,1H3,(H,24,27) |
| InChIKey | VALMFUIGTQTNOU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|