C19H23F3N2O2 — CID 7830866
(5R,9S)-7,7,9-trimethyl-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7830866) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (5R,9S)-7,7,9-trimethyl-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,9S)-7,7,9-trimethyl-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7830866 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (5R,9S)-7,7,9-trimethyl-3-[[3-(trifluoromethyl)phenyl]methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(Cc1cccc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C19H23F3N2O2/c1-12-8-17(2,3)11-18(9-12)15(25)24(16(26)23-18)10-13-5-4-6-14(7-13)19(20,21)22/h4-7,12H,8-11H2,1-3H3,(H,23,26)/t12-,18+/m0/s1 |
| InChIKey | VJBOOJURUIVOAL-KPZWWZAWSA-N |
| XLogP | 4.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|