C17H13Cl2FN2O2 — CID 56518049
5-(2-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 56518049) has the molecular formula C17H13Cl2FN2O2 and a molecular weight of 367.21 g/mol. Its IUPAC name is 5-(2-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56518049 |
| Molecular Formula | C17H13Cl2FN2O2 |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 5-(2-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2Cl)NC(=O)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H13Cl2FN2O2/c1-17(13-7-6-12(20)8-14(13)19)15(23)22(16(24)21-17)9-10-2-4-11(18)5-3-10/h2-8H,9H2,1H3,(H,21,24) |
| InChIKey | MLMVLROZCIAMFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|