C18H16F2N2O3 — CID 110005287
5-(2,4-difluorophenyl)-3-[[4-(hydroxymethyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 110005287) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-3-[[4-(hydroxymethyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,4-difluorophenyl)-3-[[4-(hydroxymethyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 110005287 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-(2,4-difluorophenyl)-3-[[4-(hydroxymethyl)phenyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2F)NC(=O)N(Cc2ccc(CO)cc2)C1=O |
| InChI | InChI=1S/C18H16F2N2O3/c1-18(14-7-6-13(19)8-15(14)20)16(24)22(17(25)21-18)9-11-2-4-12(10-23)5-3-11/h2-8,23H,9-10H2,1H3,(H,21,25) |
| InChIKey | KZJHYWQEWBUJFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|