C20H16ClFN4O3 — CID 56517084
3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-5-(2-chloro-4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 56517084) has the molecular formula C20H16ClFN4O3 and a molecular weight of 414.82 g/mol. Its IUPAC name is 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-5-(2-chloro-4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-5-(2-chloro-4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56517084 |
| Molecular Formula | C20H16ClFN4O3 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-5-(2-chloro-4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)cc2Cl)NC(=O)N(Cc2nnc(Cc3ccccc3)o2)C1=O |
| InChI | InChI=1S/C20H16ClFN4O3/c1-20(14-8-7-13(22)10-15(14)21)18(27)26(19(28)23-20)11-17-25-24-16(29-17)9-12-5-3-2-4-6-12/h2-8,10H,9,11H2,1H3,(H,23,28) |
| InChIKey | KVEVDSPLGBAARD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|