C21H16ClFN2O4 — CID 56517853
5-(2-chloro-4-fluorophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 56517853) has the molecular formula C21H16ClFN2O4 and a molecular weight of 414.82 g/mol. Its IUPAC name is 5-(2-chloro-4-fluorophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2-chloro-4-fluorophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56517853 |
| Molecular Formula | C21H16ClFN2O4 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-(2-chloro-4-fluorophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(CN3C(=O)NC(C)(c4ccc(F)cc4Cl)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H16ClFN2O4/c1-11-3-5-14-12(8-18(26)29-17(14)7-11)10-25-19(27)21(2,24-20(25)28)15-6-4-13(23)9-16(15)22/h3-9H,10H2,1-2H3,(H,24,28) |
| InChIKey | DREFAEMYDFLHMU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|