C21H17ClN2O5 — CID 5032782
5-(4-chlorophenyl)-3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 5032782) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5032782 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(CN3C(=O)NC(C)(c4ccc(Cl)cc4)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H17ClN2O5/c1-21(13-3-5-14(22)6-4-13)19(26)24(20(27)23-21)11-12-9-18(25)29-17-10-15(28-2)7-8-16(12)17/h3-10H,11H2,1-2H3,(H,23,27) |
| InChIKey | XFFCJKUYFFDJQF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|