C21H18N2O5S — CID 7771802
(4S)-3'-[(7-methoxy-2-oxochromen-4-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 7771802) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is (4S)-3'-[(7-methoxy-2-oxochromen-4-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[(7-methoxy-2-oxochromen-4-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 7771802 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (4S)-3'-[(7-methoxy-2-oxochromen-4-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1ccc2c(CN3C(=O)N[C@]4(CCCc5sccc54)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H18N2O5S/c1-27-13-4-5-14-12(9-18(24)28-16(14)10-13)11-23-19(25)21(22-20(23)26)7-2-3-17-15(21)6-8-29-17/h4-6,8-10H,2-3,7,11H2,1H3,(H,22,26)/t21-/m0/s1 |
| InChIKey | UVVGHRPFKQFNDB-NRFANRHFSA-N |
| XLogP | 3.15 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|