C24H18N2O4S — CID 41136752
(4R)-3'-[(3-oxobenzo[f]chromen-1-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41136752) has the molecular formula C24H18N2O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is (4R)-3'-[(3-oxobenzo[f]chromen-1-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(3-oxobenzo[f]chromen-1-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41136752 |
| Molecular Formula | C24H18N2O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (4R)-3'-[(3-oxobenzo[f]chromen-1-yl)methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCCc3sccc32)C(=O)N1Cc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C24H18N2O4S/c27-20-12-15(21-16-5-2-1-4-14(16)7-8-18(21)30-20)13-26-22(28)24(25-23(26)29)10-3-6-19-17(24)9-11-31-19/h1-2,4-5,7-9,11-12H,3,6,10,13H2,(H,25,29)/t24-/m1/s1 |
| InChIKey | JPHLAHJVGKDELO-XMMPIXPASA-N |
| XLogP | 4.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|