C19H15ClN4O3S — CID 41143646
(4S)-3'-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41143646) has the molecular formula C19H15ClN4O3S and a molecular weight of 414.87 g/mol. Its IUPAC name is (4S)-3'-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41143646 |
| Molecular Formula | C19H15ClN4O3S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (4S)-3'-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@]2(CCCc3sccc32)C(=O)N1Cc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C19H15ClN4O3S/c20-13-5-2-1-4-11(13)16-21-15(27-23-16)10-24-17(25)19(22-18(24)26)8-3-6-14-12(19)7-9-28-14/h1-2,4-5,7,9H,3,6,8,10H2,(H,22,26)/t19-/m0/s1 |
| InChIKey | QTXZKUKSRMQVSC-IBGZPJMESA-N |
| XLogP | 3.74 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|