C21H18N4O3 — CID 8023134
(4R)-3'-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 8023134) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is (4R)-3'-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 8023134 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (4R)-3'-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCCc3ccccc32)C(=O)N1Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H18N4O3/c26-19-21(12-6-10-14-7-4-5-11-16(14)21)23-20(27)25(19)13-17-22-18(24-28-17)15-8-2-1-3-9-15/h1-5,7-9,11H,6,10,12-13H2,(H,23,27)/t21-/m1/s1 |
| InChIKey | JSAPISCYXRUPSW-OAQYLSRUSA-N |
| XLogP | 3.02 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|