C19H18N2O2 — CID 4810140
3'-benzylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 4810140) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 3'-benzylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-benzylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 4810140 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3'-benzylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCc3ccccc32)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2/c22-17-19(12-6-10-15-9-4-5-11-16(15)19)20-18(23)21(17)13-14-7-2-1-3-8-14/h1-5,7-9,11H,6,10,12-13H2,(H,20,23) |
| InChIKey | QPXFNOWMNMDTGM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|