C21H20N2O4 — CID 2705977
methyl 4-[[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]methyl]benzoate (PubChem CID 2705977) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 4-[[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]methyl]benzoate |
|---|---|
| PubChem CID | 2705977 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 4-[[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N[C@@]3(CCCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-27-18(24)16-10-8-14(9-11-16)13-23-19(25)21(22-20(23)26)12-4-6-15-5-2-3-7-17(15)21/h2-3,5,7-11H,4,6,12-13H2,1H3,(H,22,26)/t21-/m1/s1 |
| InChIKey | RRHBMMJKMMIWIP-OAQYLSRUSA-N |
| XLogP | 2.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|