C19H16Cl2N2O2 — CID 2102939
(4S)-3'-[(3,4-dichlorophenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 2102939) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (4S)-3'-[(3,4-dichlorophenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[(3,4-dichlorophenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 2102939 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (4S)-3'-[(3,4-dichlorophenyl)methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@]2(CCCc3ccccc32)C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-15-8-7-12(10-16(15)21)11-23-17(24)19(22-18(23)25)9-3-5-13-4-1-2-6-14(13)19/h1-2,4,6-8,10H,3,5,9,11H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | DDFFQGIZSXCTKX-IBGZPJMESA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|