C21H17N3O3 — CID 41187001
(3R)-3'-[(5-phenyl-1,2-oxazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 41187001) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (3R)-3'-[(5-phenyl-1,2-oxazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-3'-[(5-phenyl-1,2-oxazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41187001 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (3R)-3'-[(5-phenyl-1,2-oxazol-3-yl)methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCc3ccccc32)C(=O)N1Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C21H17N3O3/c25-19-21(11-10-14-6-4-5-9-17(14)21)22-20(26)24(19)13-16-12-18(27-23-16)15-7-2-1-3-8-15/h1-9,12H,10-11,13H2,(H,22,26)/t21-/m1/s1 |
| InChIKey | BZGXATCUCADYNQ-OAQYLSRUSA-N |
| XLogP | 3.24 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|