C24H24N4O3 — CID 166228870
3'-[[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 166228870) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3'-[[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 166228870 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3'-[[3-[(2-methylphenyl)methyl]-1,2,4-oxadiazol-5-yl]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccccc1Cc1noc(CN2C(=O)NC3(CCCCc4ccccc43)C2=O)n1 |
| InChI | InChI=1S/C24H24N4O3/c1-16-8-2-3-11-18(16)14-20-25-21(31-27-20)15-28-22(29)24(26-23(28)30)13-7-6-10-17-9-4-5-12-19(17)24/h2-5,8-9,11-12H,6-7,10,13-15H2,1H3,(H,26,30) |
| InChIKey | NMMHMDXYDOHHOX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|