C25H23N3O3S — CID 78845669
3'-(3-carbazol-9-yl-2-hydroxypropyl)spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 78845669) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 3'-(3-carbazol-9-yl-2-hydroxypropyl)spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(3-carbazol-9-yl-2-hydroxypropyl)spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 78845669 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3'-(3-carbazol-9-yl-2-hydroxypropyl)spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCc3sccc32)C(=O)N1CC(O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C25H23N3O3S/c29-16(14-27-20-8-3-1-6-17(20)18-7-2-4-9-21(18)27)15-28-23(30)25(26-24(28)31)12-5-10-22-19(25)11-13-32-22/h1-4,6-9,11,13,16,29H,5,10,12,14-15H2,(H,26,31) |
| InChIKey | FHVNMWFIQGMITI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|