C23H22N2O4 — CID 2633767
(5R,6S)-6-methyl-3-[(3-oxobenzo[f]chromen-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 2633767) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (5R,6S)-6-methyl-3-[(3-oxobenzo[f]chromen-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-6-methyl-3-[(3-oxobenzo[f]chromen-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 2633767 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (5R,6S)-6-methyl-3-[(3-oxobenzo[f]chromen-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(Cc1cc(=O)oc3ccc4ccccc4c13)C2=O |
| InChI | InChI=1S/C23H22N2O4/c1-14-6-4-5-11-23(14)21(27)25(22(28)24-23)13-16-12-19(26)29-18-10-9-15-7-2-3-8-17(15)20(16)18/h2-3,7-10,12,14H,4-6,11,13H2,1H3,(H,24,28)/t14-,23+/m0/s1 |
| InChIKey | QAGCYQWGXQKWIQ-LFVRLGFBSA-N |
| XLogP | 3.95 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|