C17H19N3O2 — CID 3984831
2-[(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzonitrile (PubChem CID 3984831) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzonitrile.
| Compound Name | 2-[(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 3984831 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]benzonitrile |
| SMILES | CC1CCCCC12NC(=O)N(Cc1ccccc1C#N)C2=O |
| InChI | InChI=1S/C17H19N3O2/c1-12-6-4-5-9-17(12)15(21)20(16(22)19-17)11-14-8-3-2-7-13(14)10-18/h2-3,7-8,12H,4-6,9,11H2,1H3,(H,19,22) |
| InChIKey | SOIZEVXSILTZTP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|