C17H19N3O2 — CID 2081807
4-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]benzonitrile (PubChem CID 2081807) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 2081807 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[[(5R,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]benzonitrile |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(Cc1ccc(C#N)cc1)C2=O |
| InChI | InChI=1S/C17H19N3O2/c1-12-4-2-3-9-17(12)15(21)20(16(22)19-17)11-14-7-5-13(10-18)6-8-14/h5-8,12H,2-4,9,11H2,1H3,(H,19,22)/t12-,17-/m1/s1 |
| InChIKey | NCRYVUUVONMELX-SJKOYZFVSA-N |
| XLogP | 2.56 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|