C14H19N3O3 — CID 8943443
(5S,6S)-6-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 8943443) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (5S,6S)-6-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6S)-6-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 8943443 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (5S,6S)-6-methyl-3-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(CN2C(=O)N[C@]3(CCCC[C@@H]3C)C2=O)no1 |
| InChI | InChI=1S/C14H19N3O3/c1-9-5-3-4-6-14(9)12(18)17(13(19)15-14)8-11-7-10(2)20-16-11/h7,9H,3-6,8H2,1-2H3,(H,15,19)/t9-,14-/m0/s1 |
| InChIKey | AZWRPEGQBGQWQQ-XPTSAGLGSA-N |
| XLogP | 1.98 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|