C17H22N2O2 — CID 40898355
(5R,6R)-6-methyl-3-[(3-methylphenyl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 40898355) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (5R,6R)-6-methyl-3-[(3-methylphenyl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-6-methyl-3-[(3-methylphenyl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 40898355 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (5R,6R)-6-methyl-3-[(3-methylphenyl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)N[C@@]3(CCCC[C@H]3C)C2=O)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-12-6-5-8-14(10-12)11-19-15(20)17(18-16(19)21)9-4-3-7-13(17)2/h5-6,8,10,13H,3-4,7,9,11H2,1-2H3,(H,18,21)/t13-,17-/m1/s1 |
| InChIKey | QOYKDQMQZKKCII-CXAGYDPISA-N |
| XLogP | 3.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|