C19H28N3O2+ — CID 11924327
methyl-[[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(2-methylphenyl)methyl]azanium (PubChem CID 11924327) has the molecular formula C19H28N3O2+ and a molecular weight of 330.45 g/mol. Its IUPAC name is methyl-[[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(2-methylphenyl)methyl]azanium.
| Compound Name | methyl-[[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 11924327 |
| Molecular Formula | C19H28N3O2+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl-[[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-[(2-methylphenyl)methyl]azanium |
| SMILES | Cc1ccccc1C[NH+](C)CN1C(=O)N[C@@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-14-8-4-5-10-16(14)12-21(3)13-22-17(23)19(20-18(22)24)11-7-6-9-15(19)2/h4-5,8,10,15H,6-7,9,11-13H2,1-3H3,(H,20,24)/p+1/t15-,19+/m0/s1 |
| InChIKey | FEJDNVMYXXKGHL-HNAYVOBHSA-O |
| XLogP | 1.47 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|