C20H21ClN2O4 — CID 7265180
(5R,6R)-3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7265180) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is (5R,6R)-3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7265180 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (5R,6R)-3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc2oc(=O)cc(CN3C(=O)N[C@@]4(CCCC[C@H]4C)C3=O)c2cc1Cl |
| InChI | InChI=1S/C20H21ClN2O4/c1-11-7-16-14(9-15(11)21)13(8-17(24)27-16)10-23-18(25)20(22-19(23)26)6-4-3-5-12(20)2/h7-9,12H,3-6,10H2,1-2H3,(H,22,26)/t12-,20-/m1/s1 |
| InChIKey | HXTVMIYYTSRDKV-MPBGBICISA-N |
| XLogP | 3.76 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|