C18H19ClN2O4 — CID 7181061
3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5,5-diethylimidazolidine-2,4-dione (PubChem CID 7181061) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181061 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(Cc2cc(=O)oc3cc(C)c(Cl)cc23)C1=O |
| InChI | InChI=1S/C18H19ClN2O4/c1-4-18(5-2)16(23)21(17(24)20-18)9-11-7-15(22)25-14-6-10(3)13(19)8-12(11)14/h6-8H,4-5,9H2,1-3H3,(H,20,24) |
| InChIKey | GUNOWWQUWHBQIK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|