C17H10Cl2F3NO3 — CID 2467447
3-chloro-1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 2467447) has the molecular formula C17H10Cl2F3NO3 and a molecular weight of 404.17 g/mol. Its IUPAC name is 3-chloro-1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-chloro-1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 2467447 |
| Molecular Formula | C17H10Cl2F3NO3 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 3-chloro-1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | Cc1cc2oc(=O)cc(Cn3cc(C(F)(F)F)cc(Cl)c3=O)c2cc1Cl |
| InChI | InChI=1S/C17H10Cl2F3NO3/c1-8-2-14-11(5-12(8)18)9(3-15(24)26-14)6-23-7-10(17(20,21)22)4-13(19)16(23)25/h2-5,7H,6H2,1H3 |
| InChIKey | JOTBQDGDIQPDAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|