C18H17ClN2O5S — CID 7828925
1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide (PubChem CID 7828925) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide.
| Compound Name | 1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 7828925 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]-N,N-dimethyl-6-oxopyridine-3-sulfonamide |
| SMILES | Cc1cc2oc(=O)cc(Cn3cc(S(=O)(=O)N(C)C)ccc3=O)c2cc1Cl |
| InChI | InChI=1S/C18H17ClN2O5S/c1-11-6-16-14(8-15(11)19)12(7-18(23)26-16)9-21-10-13(4-5-17(21)22)27(24,25)20(2)3/h4-8,10H,9H2,1-3H3 |
| InChIKey | QJBAGDWCCNGNEH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|