C18H18ClNO2S — CID 9434013
6-chloro-7-methyl-4-[[methyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]chromen-2-one (PubChem CID 9434013) has the molecular formula C18H18ClNO2S and a molecular weight of 347.87 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-[[methyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-[[methyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9434013 |
| Molecular Formula | C18H18ClNO2S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 6-chloro-7-methyl-4-[[methyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)Cc3sccc3C)c2cc1Cl |
| InChI | InChI=1S/C18H18ClNO2S/c1-11-4-5-23-17(11)10-20(3)9-13-7-18(21)22-16-6-12(2)15(19)8-14(13)16/h4-8H,9-10H2,1-3H3 |
| InChIKey | MFCGIFWBGDJPNE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|