C21H22ClNO3 — CID 55839358
6-chloro-4-[[cyclopentyl(furan-2-ylmethyl)amino]methyl]-7-methylchromen-2-one (PubChem CID 55839358) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 6-chloro-4-[[cyclopentyl(furan-2-ylmethyl)amino]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[cyclopentyl(furan-2-ylmethyl)amino]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 55839358 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 6-chloro-4-[[cyclopentyl(furan-2-ylmethyl)amino]methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(Cc3ccco3)C3CCCC3)c2cc1Cl |
| InChI | InChI=1S/C21H22ClNO3/c1-14-9-20-18(11-19(14)22)15(10-21(24)26-20)12-23(16-5-2-3-6-16)13-17-7-4-8-25-17/h4,7-11,16H,2-3,5-6,12-13H2,1H3 |
| InChIKey | HATVLJVPZKVTEV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|