C20H20ClN2O4+ — CID 2690286
6-chloro-4-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one (PubChem CID 2690286) has the molecular formula C20H20ClN2O4+ and a molecular weight of 387.84 g/mol. Its IUPAC name is 6-chloro-4-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 2690286 |
| Molecular Formula | C20H20ClN2O4+ |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 6-chloro-4-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(C[NH+]3CCN(C(=O)c4ccco4)CC3)c2cc1Cl |
| InChI | InChI=1S/C20H19ClN2O4/c1-13-9-18-15(11-16(13)21)14(10-19(24)27-18)12-22-4-6-23(7-5-22)20(25)17-3-2-8-26-17/h2-3,8-11H,4-7,12H2,1H3/p+1 |
| InChIKey | LDKFYIDHBWXOTQ-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|