C22H27ClN2O3+2 — CID 9255903
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]azanium (PubChem CID 9255903) has the molecular formula C22H27ClN2O3+2 and a molecular weight of 402.92 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]azanium.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9255903 |
| Molecular Formula | C22H27ClN2O3+2 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]C[C@H](c3ccco3)[NH+]3CCCCC3)c2cc1Cl |
| InChI | InChI=1S/C22H25ClN2O3/c1-15-10-21-17(12-18(15)23)16(11-22(26)28-21)13-24-14-19(20-6-5-9-27-20)25-7-3-2-4-8-25/h5-6,9-12,19,24H,2-4,7-8,13-14H2,1H3/p+2/t19-/m1/s1 |
| InChIKey | VFDBXMGPHMKSOQ-LJQANCHMSA-P |
| XLogP | 2.22 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|